CAS 127690-37-3 is the registry number for Chloro(dimesitylphosphine)gold, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
CAS 127690-37-3 identifies a chemical compound with the molecular formula C18H22AuClP and a molecular weight of 501.8 g/mol. InChIKey: ONRKQSODGFOMMM-UHFFFAOYSA-M.
| Molecular formula | C18H22AuClP |
|---|---|
| Molecular weight | 501.8 g/mol |
| InChIKey | ONRKQSODGFOMMM-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)[P]C2=C(C=C(C=C2C)C)C)C.Cl[Au] |
Computed by PubChem (NCBI)