CAS 1277-47-0 appears in our catalog under these names: Bis(cyclopentadienyl)vanadium, 98%, Bis(cyclopentadienyl)vanadium. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g, 5g.
Bis(cyclopenta-1,3-diene);vanadium(2+) (CAS 1277-47-0) is a chemical compound with the molecular formula C10H10V and a molecular weight of 181.13 g/mol. IUPAC name: bis(cyclopenta-1,3-diene);vanadium(2+). InChIKey: YXQWGVLNDXNSJJ-UHFFFAOYSA-N.
| Molecular formula | C10H10V |
|---|---|
| Molecular weight | 181.13 g/mol |
| IUPAC name | bis(cyclopenta-1,3-diene);vanadium(2+) |
| InChIKey | YXQWGVLNDXNSJJ-UHFFFAOYSA-N |
| SMILES | [CH-]1C=CC=C1.[CH-]1C=CC=C1.[V+2] |
Computed by PubChem (NCBI)