CAS 1277097-48-9 appears in our catalog under these names: (2S,3R)-1-(tert-Butoxycarbonyl)-3-methylazetidine-2-carboxylic acid, 98%, (2S，3R)–1–((tert–Butoxy)carbonyl)–3–methylazetidine–2–carboxylic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg.
(2S,3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid (CAS 1277097-48-9) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: (2S,3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid. InChIKey: CWCHGLNUHDOFHF-RQJHMYQMSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (2S,3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid |
| InChIKey | CWCHGLNUHDOFHF-RQJHMYQMSA-N |
| SMILES | C[C@@H]1CN([C@@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)