CAS 1277178-30-9 is the registry number for 8-Nitro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-nitro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (CAS 1277178-30-9) is a chemical compound with the molecular formula C7H3F3N4O2 and a molecular weight of 232.12 g/mol. IUPAC name: 8-nitro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: YLQXISQZGQAKAE-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N4O2 |
|---|---|
| Molecular weight | 232.12 g/mol |
| IUPAC name | 8-nitro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | YLQXISQZGQAKAE-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NN=CN2C=C1C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)