CAS 127783-34-0 appears in our catalog under these names: Ethynyl(phenyl)iodonium tetrafluoroborate, 95%, Ethynyl(phenyl)iodonium tetrafluoroborate, 97%, Ethynyl(phenyl)iodonium Tetrafluoroborate, Ethynyl(phenyl)iodonium Tetrafluoroborate [Ethynylating Reagent], >97.0%(T), Ethynyl(phenyl)iodonium tetrafluoroborate, 97.0%, 97.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, 200mg.
Ethynyl(phenyl)iodanium tetrafluoroborate (CAS 127783-34-0) is a chemical compound with the molecular formula C8H6BF4I and a molecular weight of 315.84 g/mol. IUPAC name: ethynyl(phenyl)iodanium tetrafluoroborate. InChIKey: AVSBPVBKCONUGF-UHFFFAOYSA-N.
| Molecular formula | C8H6BF4I |
|---|---|
| Molecular weight | 315.84 g/mol |
| IUPAC name | ethynyl(phenyl)iodanium tetrafluoroborate |
| InChIKey | AVSBPVBKCONUGF-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C#C[I+]C1=CC=CC=C1 |
Computed by PubChem (NCBI)