CAS 127783-36-2 appears in our catalog under these names: Trimethylsilylethynyl(phenyl)iodonium tetrafluoroborate, 98%, Trimethylsilylethynyl(phenyl)iodoniumtetrafluoroborate, 95%, Trimethylsilylethynyl(phenyl)iodonium Tetrafluoroborate, Trimethylsilylethynyl(phenyl)iodonium Tetrafluoroborate, Trimethylsilylethynyl(phenyl)iodonium Tetrafluoroborate, >98.0%(T). Offered by: Combi-blocks, AmBeed, TRC, GLPBio, TCI. Available pack sizes: 1g, 250mg, 5g.
Phenyl(2-trimethylsilylethynyl)iodanium tetrafluoroborate (CAS 127783-36-2) is a chemical compound with the molecular formula C11H14BF4ISi and a molecular weight of 388.02 g/mol. IUPAC name: phenyl(2-trimethylsilylethynyl)iodanium tetrafluoroborate. InChIKey: QHLUVBBDXOGLSV-UHFFFAOYSA-N.
| Molecular formula | C11H14BF4ISi |
|---|---|
| Molecular weight | 388.02 g/mol |
| IUPAC name | phenyl(2-trimethylsilylethynyl)iodanium tetrafluoroborate |
| InChIKey | QHLUVBBDXOGLSV-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C[Si](C)(C)C#C[I+]C1=CC=CC=C1 |
Computed by PubChem (NCBI)