CAS 127842-66-4 appears in our catalog under these names: {4-((Trifluoromethyl)sulfanyl)phenyl}methanae hydrochloride, (4-[(Trifluoromethyl)sulfanyl]phenyl)methanamine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
[4-(trifluoromethylsulfanyl)phenyl]methanamine;hydrochloride (CAS 127842-66-4) is a chemical compound with the molecular formula C8H9ClF3NS and a molecular weight of 243.68 g/mol. IUPAC name: [4-(trifluoromethylsulfanyl)phenyl]methanamine;hydrochloride. InChIKey: HSSWIGTXFACQPN-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NS |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | [4-(trifluoromethylsulfanyl)phenyl]methanamine;hydrochloride |
| InChIKey | HSSWIGTXFACQPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)SC(F)(F)F.Cl |
Computed by PubChem (NCBI)