CAS 1278522-47-6 is the registry number for 3,7-Dichloro-5,5-dimethyl-5H-dibenzo[b,f]silepine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,9-dichloro-11,11-dimethylbenzo[b][1]benzosilepine (CAS 1278522-47-6) is a chemical compound with the molecular formula C16H14Cl2Si and a molecular weight of 305.3 g/mol. IUPAC name: 2,9-dichloro-11,11-dimethylbenzo[b][1]benzosilepine. InChIKey: ZCFKMDXIQYMYBF-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2Si |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 2,9-dichloro-11,11-dimethylbenzo[b][1]benzosilepine |
| InChIKey | ZCFKMDXIQYMYBF-UHFFFAOYSA-N |
| SMILES | C[Si]1(C2=C(C=CC3=C1C=C(C=C3)Cl)C=CC(=C2)Cl)C |
Computed by PubChem (NCBI)