CAS 127854-46-0 is the registry number for Dimethyl (4S,5S)-1,3,2-dioxathiolane-4,5-dicarboxylate 2,2-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl (4S,5S)-2,2-dioxo-1,3,2-dioxathiolane-4,5-dicarboxylate (CAS 127854-46-0) is a chemical compound with the molecular formula C6H8O8S and a molecular weight of 240.19 g/mol. IUPAC name: dimethyl (4S,5S)-2,2-dioxo-1,3,2-dioxathiolane-4,5-dicarboxylate. InChIKey: YZPCWPMIVKWDOZ-IMJSIDKUSA-N.
| Molecular formula | C6H8O8S |
|---|---|
| Molecular weight | 240.19 g/mol |
| IUPAC name | dimethyl (4S,5S)-2,2-dioxo-1,3,2-dioxathiolane-4,5-dicarboxylate |
| InChIKey | YZPCWPMIVKWDOZ-IMJSIDKUSA-N |
| SMILES | COC(=O)[C@@H]1[C@H](OS(=O)(=O)O1)C(=O)OC |
Computed by PubChem (NCBI)