CAS 1279049-31-8 appears in our catalog under these names: (2R,3S)-2-Amino-3-hydroxy-4,4-dimethylpentanoic acid, 95%, 95%, (3S)-H-3-tBu-D-Ser-OH, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2R,3S)-2-amino-3-hydroxy-4,4-dimethylpentanoic acid (CAS 1279049-31-8) is a chemical compound with the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. IUPAC name: (2R,3S)-2-amino-3-hydroxy-4,4-dimethylpentanoic acid. InChIKey: DREONSBNBZFXLW-RFZPGFLSSA-N.
| Molecular formula | C7H15NO3 |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | (2R,3S)-2-amino-3-hydroxy-4,4-dimethylpentanoic acid |
| InChIKey | DREONSBNBZFXLW-RFZPGFLSSA-N |
| SMILES | CC(C)(C)[C@@H]([C@H](C(=O)O)N)O |
Computed by PubChem (NCBI)