CAS 1279107-82-2 is the registry number for 4-(N,N-Dimethylsulfamoyl)-2-trifluoromethylphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(dimethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid (CAS 1279107-82-2) is a chemical compound with the molecular formula C9H11BF3NO4S and a molecular weight of 297.06 g/mol. IUPAC name: [4-(dimethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: SYZSCAQVGVKZPK-UHFFFAOYSA-N.
| Molecular formula | C9H11BF3NO4S |
|---|---|
| Molecular weight | 297.06 g/mol |
| IUPAC name | [4-(dimethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | SYZSCAQVGVKZPK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)N(C)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)