Products 127913-30-8
CAS 127913-30-8 is the registry number for (4R,5R)-4-(Hydroxymethyl)-5-methyloxazolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R,5R)-4-(hydroxymethyl)-5-methyl-1,3-oxazolidin-2-one (CAS 127913-30-8) is a chemical compound with the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. IUPAC name: (4R,5R)-4-(hydroxymethyl)-5-methyl-1,3-oxazolidin-2-one. InChIKey: DSKKPLSYZLTKBE-QWWZWVQMSA-N.
| Molecular formula | C5H9NO3 |
|---|---|
| Molecular weight | 131.13 g/mol |
| IUPAC name | (4R,5R)-4-(hydroxymethyl)-5-methyl-1,3-oxazolidin-2-one |
| InChIKey | DSKKPLSYZLTKBE-QWWZWVQMSA-N |
| SMILES | C[C@@H]1[C@H](NC(=O)O1)CO |
Computed by PubChem (NCBI)