Products 127930-80-7
CAS 127930-80-7 is the registry number for Lorazepam hemisuccinate. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]oxy]-4-oxobutanoic acid (CAS 127930-80-7) is a chemical compound with the molecular formula C19H14Cl2N2O5 and a molecular weight of 421.2 g/mol. IUPAC name: 4-[[7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]oxy]-4-oxobutanoic acid. InChIKey: NFXVKMXGODLOOD-UHFFFAOYSA-N.
| Molecular formula | C19H14Cl2N2O5 |
|---|---|
| Molecular weight | 421.2 g/mol |
| IUPAC name | 4-[[7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]oxy]-4-oxobutanoic acid |
| InChIKey | NFXVKMXGODLOOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(C(=O)NC3=C2C=C(C=C3)Cl)OC(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
Lorazepam hemisuccinate