CAS 127956-25-6 is the registry number for 6-Bromomethyl-indole-1-carboxylic acid tert-butyl ester, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 6-(bromomethyl)indole-1-carboxylate (CAS 127956-25-6) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: tert-butyl 6-(bromomethyl)indole-1-carboxylate. InChIKey: PFUSKZCXUUIMNV-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO2 |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | tert-butyl 6-(bromomethyl)indole-1-carboxylate |
| InChIKey | PFUSKZCXUUIMNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)CBr |
Computed by PubChem (NCBI)