Products 127956-25-6

CAS 127956-25-6 is the registry number for 6-Bromomethyl-indole-1-carboxylic acid tert-butyl ester, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Tert-butyl 6-(bromomethyl)indole-1-carboxylate (CAS 127956-25-6) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: tert-butyl 6-(bromomethyl)indole-1-carboxylate. InChIKey: PFUSKZCXUUIMNV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16BrNO2
Molecular weight310.19 g/mol
IUPAC nametert-butyl 6-(bromomethyl)indole-1-carboxylate
InChIKeyPFUSKZCXUUIMNV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)CBr

Computed by PubChem (NCBI)