CAS 127975-78-4 is the registry number for FR 75513. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-O-methyl 1-O-propan-2-yl 4-hydroxy-6-methyl-2-(2-nitrophenyl)benzene-1,3-dicarboxylate (CAS 127975-78-4) is a chemical compound with the molecular formula C19H19NO7 and a molecular weight of 373.4 g/mol. IUPAC name: 3-O-methyl 1-O-propan-2-yl 4-hydroxy-6-methyl-2-(2-nitrophenyl)benzene-1,3-dicarboxylate. InChIKey: XSAOKGZBHYQDNI-UHFFFAOYSA-N.
| Molecular formula | C19H19NO7 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 3-O-methyl 1-O-propan-2-yl 4-hydroxy-6-methyl-2-(2-nitrophenyl)benzene-1,3-dicarboxylate |
| InChIKey | XSAOKGZBHYQDNI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC(C)C)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC)O |
Computed by PubChem (NCBI)