CAS 127985-74-4 appears in our catalog under these names: p-SCN-Bn-DOTA, P-SCN-Bn-DOTA/ 95.03% (existing batch purity), p–SCN–Bn–DOTA, p-SCN-Bn-DOTA 95%, 2-[(4-Isothiocyanatophenyl)methyl]-1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetic acid, 95%, 95%. Offered by: Chemat Brand, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
2-[4,7,10-tris(carboxymethyl)-6-[(4-isothiocyanatophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (CAS 127985-74-4) is a chemical compound with the molecular formula C24H33N5O8S and a molecular weight of 551.6 g/mol. IUPAC name: 2-[4,7,10-tris(carboxymethyl)-6-[(4-isothiocyanatophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid. InChIKey: UDOPJKHABYSVIX-UHFFFAOYSA-N.
| Molecular formula | C24H33N5O8S |
|---|---|
| Molecular weight | 551.6 g/mol |
| IUPAC name | 2-[4,7,10-tris(carboxymethyl)-6-[(4-isothiocyanatophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| InChIKey | UDOPJKHABYSVIX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(C(CN(CCN1CC(=O)O)CC(=O)O)CC2=CC=C(C=C2)N=C=S)CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)