CAS 1279882-85-7 is the registry number for Bis-1,4-n,n-(2-hydroxyethylamino)-2-nitro benzene sulphate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-[4-(2-hydroxyethylamino)-3-nitroanilino]ethanol;sulfuric acid (CAS 1279882-85-7) is a chemical compound with the molecular formula C10H17N3O8S and a molecular weight of 339.32 g/mol. IUPAC name: 2-[4-(2-hydroxyethylamino)-3-nitroanilino]ethanol;sulfuric acid. InChIKey: ROBQSIZJZNEYFH-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O8S |
|---|---|
| Molecular weight | 339.32 g/mol |
| IUPAC name | 2-[4-(2-hydroxyethylamino)-3-nitroanilino]ethanol;sulfuric acid |
| InChIKey | ROBQSIZJZNEYFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NCCO)[N+](=O)[O-])NCCO.OS(=O)(=O)O |
Computed by PubChem (NCBI)