CAS 128-63-2 appears in our catalog under these names: 1,3,6,8-Tetrabromopyrene, 1,3,6,8–Tetrabromopyrene, 1,3,6,8-Tetrabromopyrene, 98% , 1,3,6,8-Tetrabromopyrene, >98.0%(T), 1,3,6,8-Tetrabromopyrene 95%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 5g, 100g, 25g, 1g, 50g, 500g, 1kg.
1,3,6,8-tetrabromopyrene (CAS 128-63-2) is a chemical compound with the molecular formula C16H6Br4 and a molecular weight of 517.8 g/mol. IUPAC name: 1,3,6,8-tetrabromopyrene. InChIKey: ZKBKRTZIYOKNRG-UHFFFAOYSA-N.
| Molecular formula | C16H6Br4 |
|---|---|
| Molecular weight | 517.8 g/mol |
| IUPAC name | 1,3,6,8-tetrabromopyrene |
| InChIKey | ZKBKRTZIYOKNRG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C(C=C2Br)Br)C=CC4=C(C=C(C1=C43)Br)Br |
Computed by PubChem (NCBI)