CAS 128019-71-6 is the registry number for Z-2-Nal-chloromethylketone. Offered by: Creative Peptides, Biosynth. Available pack sizes: 250mg, 1g, 0,25g, 0,5g.
Benzyl N-[(2S)-4-chloro-1-naphthalen-2-yl-3-oxobutan-2-yl]carbamate (CAS 128019-71-6) is a chemical compound with the molecular formula C22H20ClNO3 and a molecular weight of 381.8 g/mol. IUPAC name: benzyl N-[(2S)-4-chloro-1-naphthalen-2-yl-3-oxobutan-2-yl]carbamate. InChIKey: BMGGQIBPEMUTCE-FQEVSTJZSA-N.
| Molecular formula | C22H20ClNO3 |
|---|---|
| Molecular weight | 381.8 g/mol |
| IUPAC name | benzyl N-[(2S)-4-chloro-1-naphthalen-2-yl-3-oxobutan-2-yl]carbamate |
| InChIKey | BMGGQIBPEMUTCE-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC3=CC=CC=C3C=C2)C(=O)CCl |
Computed by PubChem (NCBI)