Products 1280201-29-7
CAS 1280201-29-7 appears in our catalog under these names: 3-Isopropoxy-5-(trifluoromethyl)aniline, 95%, 3–Isopropoxy–5–(trifluoromethyl)aniline, 3-Isopropoxy-5-(trifluoromethyl)aniline. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g.
3-propan-2-yloxy-5-(trifluoromethyl)aniline (CAS 1280201-29-7) is a chemical compound with the molecular formula C10H12F3NO and a molecular weight of 219.20 g/mol. IUPAC name: 3-propan-2-yloxy-5-(trifluoromethyl)aniline. InChIKey: NQORTSLHZMPLNT-UHFFFAOYSA-N.
| Molecular formula | C10H12F3NO |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 3-propan-2-yloxy-5-(trifluoromethyl)aniline |
| InChIKey | NQORTSLHZMPLNT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=CC(=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)