CAS 1280647-32-6 is the registry number for Dapagliflozin Impurity 70. Offered by: Chemat Brand. Available pack sizes: on request.
(5-bromo-2-chlorophenyl)-(4-ethoxyphenyl)methanol (CAS 1280647-32-6) is a chemical compound with the molecular formula C15H14BrClO2 and a molecular weight of 341.62 g/mol. IUPAC name: (5-bromo-2-chlorophenyl)-(4-ethoxyphenyl)methanol. InChIKey: KOJZDDZVYDZNEH-UHFFFAOYSA-N.
| Molecular formula | C15H14BrClO2 |
|---|---|
| Molecular weight | 341.62 g/mol |
| IUPAC name | (5-bromo-2-chlorophenyl)-(4-ethoxyphenyl)methanol |
| InChIKey | KOJZDDZVYDZNEH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(C2=C(C=CC(=C2)Br)Cl)O |
Computed by PubChem (NCBI)