CAS 1280786-56-2 is the registry number for 1-Bromo-2,4-dichloro-5-(cyclopentyloxy)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-2,4-dichloro-5-cyclopentyloxybenzene (CAS 1280786-56-2) is a chemical compound with the molecular formula C11H11BrCl2O and a molecular weight of 310.01 g/mol. IUPAC name: 1-bromo-2,4-dichloro-5-cyclopentyloxybenzene. InChIKey: KGCANZVGYLSLPA-UHFFFAOYSA-N.
| Molecular formula | C11H11BrCl2O |
|---|---|
| Molecular weight | 310.01 g/mol |
| IUPAC name | 1-bromo-2,4-dichloro-5-cyclopentyloxybenzene |
| InChIKey | KGCANZVGYLSLPA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC(=C(C=C2Cl)Cl)Br |
Computed by PubChem (NCBI)