CAS 1280786-64-2 is the registry number for 3-Bromo-2-(N-t-butylamino)-5-trifluoromethylpyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
3-bromo-N-tert-butyl-5-(trifluoromethyl)pyridin-2-amine (CAS 1280786-64-2) is a chemical compound with the molecular formula C10H12BrF3N2 and a molecular weight of 297.11 g/mol. IUPAC name: 3-bromo-N-tert-butyl-5-(trifluoromethyl)pyridin-2-amine. InChIKey: ZVWGZFFDFKLWAS-UHFFFAOYSA-N.
| Molecular formula | C10H12BrF3N2 |
|---|---|
| Molecular weight | 297.11 g/mol |
| IUPAC name | 3-bromo-N-tert-butyl-5-(trifluoromethyl)pyridin-2-amine |
| InChIKey | ZVWGZFFDFKLWAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=C(C=C(C=N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)