CAS 1280786-76-6 appears in our catalog under these names: 5-Bromo-1-propylindazole, 98%, 5-Bromo-1-propyl-1H-indazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
5-bromo-1-propylindazole (CAS 1280786-76-6) is a chemical compound with the molecular formula C10H11BrN2 and a molecular weight of 239.11 g/mol. IUPAC name: 5-bromo-1-propylindazole. InChIKey: RUOLNROUDXPCPF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2 |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 5-bromo-1-propylindazole |
| InChIKey | RUOLNROUDXPCPF-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C=C(C=C2)Br)C=N1 |
Computed by PubChem (NCBI)