Products 1280835-56-4
CAS 1280835-56-4 is the registry number for 1-(3,4-Dichlorophenyl)-N-(2-methoxyethyl)methanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(3,4-dichlorophenyl)-N-(2-methoxyethyl)methanesulfonamide (CAS 1280835-56-4) is a chemical compound with the molecular formula C10H13Cl2NO3S and a molecular weight of 298.19 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-N-(2-methoxyethyl)methanesulfonamide. InChIKey: UGUIACNYNGBVOI-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO3S |
|---|---|
| Molecular weight | 298.19 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-N-(2-methoxyethyl)methanesulfonamide |
| InChIKey | UGUIACNYNGBVOI-UHFFFAOYSA-N |
| SMILES | COCCNS(=O)(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)