CAS 128095-52-3 appears in our catalog under these names: 4-Methylumbelliferyl Alpha-L-Idopyranosiduronic Acid Methyl Ester, >95% (HPLC), 4-Methylumbelliferyl α-L-idopyranosiduronic acid methyl ester. Offered by: TRC, Biosynth. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 25mg, 50mg.
Methyl (2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylate (CAS 128095-52-3) is a chemical compound with the molecular formula C17H18O9 and a molecular weight of 366.3 g/mol. IUPAC name: methyl (2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylate. InChIKey: GQDKDFCKXAEJCH-DEQQHWRFSA-N.
| Molecular formula | C17H18O9 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | methyl (2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylate |
| InChIKey | GQDKDFCKXAEJCH-DEQQHWRFSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](O3)C(=O)OC)O)O)O |
Computed by PubChem (NCBI)