CAS 1280973-68-3 is the registry number for N2,N2-Dimethyl-6-(1-(methylthio)ethyl)-1,3,5-triazine-2,4-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-N,2-N-dimethyl-6-(1-methylsulfanylethyl)-1,3,5-triazine-2,4-diamine (CAS 1280973-68-3) is a chemical compound with the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. IUPAC name: 2-N,2-N-dimethyl-6-(1-methylsulfanylethyl)-1,3,5-triazine-2,4-diamine. InChIKey: JSXDVJGRTHTYSG-UHFFFAOYSA-N.
| Molecular formula | C8H15N5S |
|---|---|
| Molecular weight | 213.31 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-6-(1-methylsulfanylethyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | JSXDVJGRTHTYSG-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NC(=N1)N(C)C)N)SC |
Computed by PubChem (NCBI)