Products 1281019-20-2
CAS 1281019-20-2 is the registry number for 1-(3,4-Dimethylphenyl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(3,4-dimethylphenyl)-2-piperazin-1-ylethanone;dihydrochloride (CAS 1281019-20-2) is a chemical compound with the molecular formula C14H22Cl2N2O and a molecular weight of 305.2 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-2-piperazin-1-ylethanone;dihydrochloride. InChIKey: WONUYXUMSZVGMM-UHFFFAOYSA-N.
| Molecular formula | C14H22Cl2N2O |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-2-piperazin-1-ylethanone;dihydrochloride |
| InChIKey | WONUYXUMSZVGMM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)CN2CCNCC2)C.Cl.Cl |
Computed by PubChem (NCBI)