CAS 128104-20-1 is the registry number for 1,1-Bis(4-fluorophenyl)-1-butene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-fluoro-4-[1-(4-fluorophenyl)but-1-enyl]benzene (CAS 128104-20-1) is a chemical compound with the molecular formula C16H14F2 and a molecular weight of 244.28 g/mol. IUPAC name: 1-fluoro-4-[1-(4-fluorophenyl)but-1-enyl]benzene. InChIKey: BGQMQAHRCSHTAQ-UHFFFAOYSA-N.
| Molecular formula | C16H14F2 |
|---|---|
| Molecular weight | 244.28 g/mol |
| IUPAC name | 1-fluoro-4-[1-(4-fluorophenyl)but-1-enyl]benzene |
| InChIKey | BGQMQAHRCSHTAQ-UHFFFAOYSA-N |
| SMILES | CCC=C(C1=CC=C(C=C1)F)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)