CAS 1281104-65-1 is the registry number for N-Isopropyl-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-oxo-N-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (CAS 1281104-65-1) is a chemical compound with the molecular formula C10H15F3N2O2 and a molecular weight of 252.23 g/mol. IUPAC name: 5-oxo-N-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide. InChIKey: JGSFZLNJDISTCM-UHFFFAOYSA-N.
| Molecular formula | C10H15F3N2O2 |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | 5-oxo-N-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| InChIKey | JGSFZLNJDISTCM-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1CC(=O)N(C1)CC(F)(F)F |
Computed by PubChem (NCBI)