CAS 1281193-55-2 is the registry number for 1-{3-((4-Chlorophenyl)methoxy)phenyl}piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[3-[(4-chlorophenyl)methoxy]phenyl]piperazine;hydrochloride (CAS 1281193-55-2) is a chemical compound with the molecular formula C17H20Cl2N2O and a molecular weight of 339.3 g/mol. IUPAC name: 1-[3-[(4-chlorophenyl)methoxy]phenyl]piperazine;hydrochloride. InChIKey: BNISSLWFHUTPFC-UHFFFAOYSA-N.
| Molecular formula | C17H20Cl2N2O |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 1-[3-[(4-chlorophenyl)methoxy]phenyl]piperazine;hydrochloride |
| InChIKey | BNISSLWFHUTPFC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC=C2)OCC3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)