CAS 1281975-40-3 appears in our catalog under these names: 1-(4-Bromo-3-fluorobenzoyl)piperidine-3-carboxylic acid, 1-(4-Bromo-3-fluorobenzoyl)piperidine-3-carboxylic acid, 95%, 1-[(4-Bromo-3-fluorophenyl)carbonyl]piperidine-3-carboxylic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 2,5g, 250mg, 5g, 1g.
1-(4-bromo-3-fluorobenzoyl)piperidine-3-carboxylic acid (CAS 1281975-40-3) is a chemical compound with the molecular formula C13H13BrFNO3 and a molecular weight of 330.15 g/mol. IUPAC name: 1-(4-bromo-3-fluorobenzoyl)piperidine-3-carboxylic acid. InChIKey: HMMVKGVSNUSGDP-UHFFFAOYSA-N.
| Molecular formula | C13H13BrFNO3 |
|---|---|
| Molecular weight | 330.15 g/mol |
| IUPAC name | 1-(4-bromo-3-fluorobenzoyl)piperidine-3-carboxylic acid |
| InChIKey | HMMVKGVSNUSGDP-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2=CC(=C(C=C2)Br)F)C(=O)O |
Computed by PubChem (NCBI)