Products 1282128-68-0

CAS 1282128-68-0 is the registry number for KB-208, 98.00%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10mM/1mL, 10 mg, 5 mg, 25 mg, 50 mg.

Structural formula: {0} (CAS {1})

Methyl 2-[1-(1-phenyl-3-thiophen-2-ylpyrazole-5-carbonyl)piperidin-4-yl]acetate (CAS 1282128-68-0) is a chemical compound with the molecular formula C22H23N3O3S and a molecular weight of 409.5 g/mol. IUPAC name: methyl 2-[1-(1-phenyl-3-thiophen-2-ylpyrazole-5-carbonyl)piperidin-4-yl]acetate. InChIKey: JBTAEQNNSPGXHO-UHFFFAOYSA-N.

Identity
Molecular formulaC22H23N3O3S
Molecular weight409.5 g/mol
IUPAC namemethyl 2-[1-(1-phenyl-3-thiophen-2-ylpyrazole-5-carbonyl)piperidin-4-yl]acetate
InChIKeyJBTAEQNNSPGXHO-UHFFFAOYSA-N
SMILESCOC(=O)CC1CCN(CC1)C(=O)C2=CC(=NN2C3=CC=CC=C3)C4=CC=CS4

Computed by PubChem (NCBI)

Synonyms: orb2945884, EiM08-20187