CAS 1282434-07-4 is the registry number for 1-{(1,2,3,4)Tetrazolo(1,5-a)pyrazin-5-yl}-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrazole-4-carboxylic acid (CAS 1282434-07-4) is a chemical compound with the molecular formula C8H5N7O2 and a molecular weight of 231.17 g/mol. IUPAC name: 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrazole-4-carboxylic acid. InChIKey: KFBBBNMSVXKAAB-UHFFFAOYSA-N.
| Molecular formula | C8H5N7O2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrazole-4-carboxylic acid |
| InChIKey | KFBBBNMSVXKAAB-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=NN=N2)C=N1)N3C=C(C=N3)C(=O)O |
Computed by PubChem (NCBI)