Products 1282434-07-4

CAS 1282434-07-4 is the registry number for 1-{(1,2,3,4)Tetrazolo(1,5-a)pyrazin-5-yl}-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrazole-4-carboxylic acid (CAS 1282434-07-4) is a chemical compound with the molecular formula C8H5N7O2 and a molecular weight of 231.17 g/mol. IUPAC name: 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrazole-4-carboxylic acid. InChIKey: KFBBBNMSVXKAAB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5N7O2
Molecular weight231.17 g/mol
IUPAC name1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrazole-4-carboxylic acid
InChIKeyKFBBBNMSVXKAAB-UHFFFAOYSA-N
SMILESC1=C(N2C(=NN=N2)C=N1)N3C=C(C=N3)C(=O)O

Computed by PubChem (NCBI)