CAS 1282555-27-4 appears in our catalog under these names: 1-(3-FLUORO-4-METHOXYPHENYL)CYCLOPROPANECARBONITRILE, 90%, 1–(3–fluoro–4–methoxyphenyl)cyclopropane–1–carbonitrile, 1-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carbonitrile. Offered by: Fluorochem, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carbonitrile (CAS 1282555-27-4) is a chemical compound with the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. IUPAC name: 1-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carbonitrile. InChIKey: UFORPFXXRBEXES-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | 1-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carbonitrile |
| InChIKey | UFORPFXXRBEXES-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2(CC2)C#N)F |
Computed by PubChem (NCBI)