CAS 1282921-62-3 is the registry number for 3-(3-Methylisoxazole-5-carboxamido)tetrahydrothiophene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(3-methyl-1,2-oxazole-5-carbonyl)amino]thiolane-3-carboxylic acid (CAS 1282921-62-3) is a chemical compound with the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. IUPAC name: 3-[(3-methyl-1,2-oxazole-5-carbonyl)amino]thiolane-3-carboxylic acid. InChIKey: WRNXWANMBHOASO-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 3-[(3-methyl-1,2-oxazole-5-carbonyl)amino]thiolane-3-carboxylic acid |
| InChIKey | WRNXWANMBHOASO-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C(=O)NC2(CCSC2)C(=O)O |
Computed by PubChem (NCBI)