Products 128298-23-7

CAS 128298-23-7 is the registry number for 3,6-Bis(trifluoromethyl)benzene-1,2,4,5-tetracarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

3,6-bis(trifluoromethyl)benzene-1,2,4,5-tetracarboxylic acid (CAS 128298-23-7) is a chemical compound with the molecular formula C12H4F6O8 and a molecular weight of 390.14 g/mol. IUPAC name: 3,6-bis(trifluoromethyl)benzene-1,2,4,5-tetracarboxylic acid. InChIKey: CDVZKYLSVNAIHH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H4F6O8
Molecular weight390.14 g/mol
IUPAC name3,6-bis(trifluoromethyl)benzene-1,2,4,5-tetracarboxylic acid
InChIKeyCDVZKYLSVNAIHH-UHFFFAOYSA-N
SMILESC1(=C(C(=C(C(=C1C(F)(F)F)C(=O)O)C(=O)O)C(F)(F)F)C(=O)O)C(=O)O

Computed by PubChem (NCBI)