CAS 128300-13-0 appears in our catalog under these names: Duocarmycin Impurity 1, (8BR,9aS)-tert-Butyl 4-oxo-9,9a-dihydro-1H-benzo(e)cyclopropa(c)indole-2(4H)-carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Tert-butyl (1R,13S)-8-oxo-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraene-11-carboxylate (CAS 128300-13-0) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: tert-butyl (1R,13S)-8-oxo-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraene-11-carboxylate. InChIKey: BSXDTBRZYMNNRS-ADLMAVQZSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | tert-butyl (1R,13S)-8-oxo-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraene-11-carboxylate |
| InChIKey | BSXDTBRZYMNNRS-ADLMAVQZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@]23C1=CC(=O)C4=CC=CC=C34 |
Computed by PubChem (NCBI)