CAS 1283087-54-6 is the registry number for 6-Chloroperfluorohexylphosphonic Acid. Offered by: TRC. Available pack sizes: 100mg.
(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)phosphonic acid (CAS 1283087-54-6) is a chemical compound with the molecular formula C6H2ClF12O3P and a molecular weight of 416.48 g/mol. IUPAC name: (6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)phosphonic acid. InChIKey: SSYJCIUXWUSGKG-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF12O3P |
|---|---|
| Molecular weight | 416.48 g/mol |
| IUPAC name | (6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)phosphonic acid |
| InChIKey | SSYJCIUXWUSGKG-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)Cl)(F)F)(F)F)(C(C(F)(F)P(=O)(O)O)(F)F)(F)F |
Computed by PubChem (NCBI)