CAS 1283146-07-5 is the registry number for ((2S,4S)-4-(Trifluoromethyl)pyrrolidin-2-yl)methanol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
[(2S,4S)-4-(trifluoromethyl)pyrrolidin-2-yl]methanol;hydrochloride (CAS 1283146-07-5) is a chemical compound with the molecular formula C6H11ClF3NO and a molecular weight of 205.60 g/mol. IUPAC name: [(2S,4S)-4-(trifluoromethyl)pyrrolidin-2-yl]methanol;hydrochloride. InChIKey: BFOBDQVXVWGSBY-FHAQVOQBSA-N.
| Molecular formula | C6H11ClF3NO |
|---|---|
| Molecular weight | 205.60 g/mol |
| IUPAC name | [(2S,4S)-4-(trifluoromethyl)pyrrolidin-2-yl]methanol;hydrochloride |
| InChIKey | BFOBDQVXVWGSBY-FHAQVOQBSA-N |
| SMILES | C1[C@@H](CN[C@@H]1CO)C(F)(F)F.Cl |
Computed by PubChem (NCBI)