CAS 1283719-69-6 is the registry number for 1-Adamantaneethylsulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
2-(1-adamantyl)ethanesulfonamide (CAS 1283719-69-6) is a chemical compound with the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. IUPAC name: 2-(1-adamantyl)ethanesulfonamide. InChIKey: QFLOGJHFNSMGRS-UHFFFAOYSA-N.
| Molecular formula | C12H21NO2S |
|---|---|
| Molecular weight | 243.37 g/mol |
| IUPAC name | 2-(1-adamantyl)ethanesulfonamide |
| InChIKey | QFLOGJHFNSMGRS-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CCS(=O)(=O)N |
Computed by PubChem (NCBI)