Products 1283720-88-6

CAS 1283720-88-6 appears in our catalog under these names: Benzyl 3,3–difluoro–4–oxopiperidine–1–carboxylate, Benzyl 3,3-difluoro-4-oxopiperidine-1-carboxylate. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.

Structural formula: {0} (CAS {1})

Benzyl 3,3-difluoro-4-oxopiperidine-1-carboxylate (CAS 1283720-88-6) is a chemical compound with the molecular formula C13H13F2NO3 and a molecular weight of 269.24 g/mol. IUPAC name: benzyl 3,3-difluoro-4-oxopiperidine-1-carboxylate. InChIKey: ZXYASFDYICUYRF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13F2NO3
Molecular weight269.24 g/mol
IUPAC namebenzyl 3,3-difluoro-4-oxopiperidine-1-carboxylate
InChIKeyZXYASFDYICUYRF-UHFFFAOYSA-N
SMILESC1CN(CC(C1=O)(F)F)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)