CAS 128376-91-0 is the registry number for 2,3,4-Tri-O-acetyl-a-D-xylopyranosyl trichloroacetimidate. Offered by: Chemat, Biosynth. Available pack sizes: 1g, 250mg, 2g, 500mg, 5g, 1000mg, 25000mg.
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (CAS 128376-91-0) is a chemical compound with the molecular formula C13H16Cl3NO8 and a molecular weight of 420.6 g/mol. IUPAC name: [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate. InChIKey: NAGHJYXWJQCCPK-LMLFDSFASA-N.
| Molecular formula | C13H16Cl3NO8 |
|---|---|
| Molecular weight | 420.6 g/mol |
| IUPAC name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| InChIKey | NAGHJYXWJQCCPK-LMLFDSFASA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC(=N)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)