CAS 1283764-23-7 is the registry number for (1,3-Dihydro-isoindol-2-yl)-(4-iodo-phenyl)-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1,3-dihydroisoindol-2-yl-(4-iodophenyl)methanone (CAS 1283764-23-7) is a chemical compound with the molecular formula C15H12INO and a molecular weight of 349.17 g/mol. IUPAC name: 1,3-dihydroisoindol-2-yl-(4-iodophenyl)methanone. InChIKey: JORCRJLBFMKTCZ-UHFFFAOYSA-N.
| Molecular formula | C15H12INO |
|---|---|
| Molecular weight | 349.17 g/mol |
| IUPAC name | 1,3-dihydroisoindol-2-yl-(4-iodophenyl)methanone |
| InChIKey | JORCRJLBFMKTCZ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CN1C(=O)C3=CC=C(C=C3)I |
Computed by PubChem (NCBI)