CAS 1284224-44-7 is the registry number for 4-(tert-pentyl)benzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-methylbutan-2-yl)benzamide (CAS 1284224-44-7) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: 4-(2-methylbutan-2-yl)benzamide. InChIKey: NNZASLXQUBORKQ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | 4-(2-methylbutan-2-yl)benzamide |
| InChIKey | NNZASLXQUBORKQ-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)C(=O)N |
Computed by PubChem (NCBI)