CAS 1284249-22-4 appears in our catalog under these names: (1R,3S,5S)-Bicyclo[3.1.0]hexan-3-amine hydrochloride, 95%, (1R,3S,5S)-bicyclo(3.1.0)hexan-3-amine hydrochloride, 98%, (1R,3S,5S)-Bicyclo(3.1.0)hexan-3-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
(1S,5R)-bicyclo[3.1.0]hexan-3-amine;hydrochloride (CAS 1284249-22-4) is a chemical compound with the molecular formula C6H12ClN and a molecular weight of 133.62 g/mol. IUPAC name: (1S,5R)-bicyclo[3.1.0]hexan-3-amine;hydrochloride. InChIKey: WNIYKDGVQDRFKU-FTEHNKOGSA-N.
| Molecular formula | C6H12ClN |
|---|---|
| Molecular weight | 133.62 g/mol |
| IUPAC name | (1S,5R)-bicyclo[3.1.0]hexan-3-amine;hydrochloride |
| InChIKey | WNIYKDGVQDRFKU-FTEHNKOGSA-N |
| SMILES | C1[C@H]2[C@@H]1CC(C2)N.Cl |
Computed by PubChem (NCBI)