CAS 1284437-05-3 is the registry number for 2–Bromo–4–chloro–1–(2,5–difluorophenyl)butan–1–one. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
2-bromo-4-chloro-1-(2,5-difluorophenyl)butan-1-one (CAS 1284437-05-3) is a chemical compound with the molecular formula C10H8BrClF2O and a molecular weight of 297.52 g/mol. IUPAC name: 2-bromo-4-chloro-1-(2,5-difluorophenyl)butan-1-one. InChIKey: BJDPPAZHPPHCIT-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClF2O |
|---|---|
| Molecular weight | 297.52 g/mol |
| IUPAC name | 2-bromo-4-chloro-1-(2,5-difluorophenyl)butan-1-one |
| InChIKey | BJDPPAZHPPHCIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)C(CCCl)Br)F |
Computed by PubChem (NCBI)