Products 128486-54-4
CAS 128486-54-4 is the registry number for Lurosetron. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-fluoro-5-methyl-2-[(5-methyl-1H-imidazol-4-yl)methyl]-3,4-dihydropyrido[4,3-b]indol-1-one (CAS 128486-54-4) is a chemical compound with the molecular formula C17H17FN4O and a molecular weight of 312.34 g/mol. IUPAC name: 6-fluoro-5-methyl-2-[(5-methyl-1H-imidazol-4-yl)methyl]-3,4-dihydropyrido[4,3-b]indol-1-one. InChIKey: NUMKWGDDRWJQMY-UHFFFAOYSA-N.
| Molecular formula | C17H17FN4O |
|---|---|
| Molecular weight | 312.34 g/mol |
| IUPAC name | 6-fluoro-5-methyl-2-[(5-methyl-1H-imidazol-4-yl)methyl]-3,4-dihydropyrido[4,3-b]indol-1-one |
| InChIKey | NUMKWGDDRWJQMY-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CN1)CN2CCC3=C(C2=O)C4=C(N3C)C(=CC=C4)F |
Computed by PubChem (NCBI)