CAS 128487-57-0 is the registry number for 3-Hydroxy Rimantadine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
3-(1-aminoethyl)adamantan-1-ol;hydrochloride (CAS 128487-57-0) is a chemical compound with the molecular formula C12H22ClNO and a molecular weight of 231.76 g/mol. IUPAC name: 3-(1-aminoethyl)adamantan-1-ol;hydrochloride. InChIKey: UXMQOOWYJIKUKR-UHFFFAOYSA-N.
| Molecular formula | C12H22ClNO |
|---|---|
| Molecular weight | 231.76 g/mol |
| IUPAC name | 3-(1-aminoethyl)adamantan-1-ol;hydrochloride |
| InChIKey | UXMQOOWYJIKUKR-UHFFFAOYSA-N |
| SMILES | CC(C12CC3CC(C1)CC(C3)(C2)O)N.Cl |
Computed by PubChem (NCBI)