Products 128495-29-4

CAS 128495-29-4 is the registry number for Plerixafor Impurity 8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)sulfonyl-1,4,8,11-tetrazacyclotetradecane (CAS 128495-29-4) is a chemical compound with the molecular formula C17H30N4O2S and a molecular weight of 354.5 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-1,4,8,11-tetrazacyclotetradecane. InChIKey: CHQVBJOMKHIJLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H30N4O2S
Molecular weight354.5 g/mol
IUPAC name1-(4-methylphenyl)sulfonyl-1,4,8,11-tetrazacyclotetradecane
InChIKeyCHQVBJOMKHIJLJ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N2CCCNCCNCCCNCC2

Computed by PubChem (NCBI)